CAS 1187385-97-2 is the registry number for 3-Cbz-Amino-2,6-dichloro-5-fluoropyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
Benzyl N-(2,6-dichloro-5-fluoro-3-pyridinyl)carbamate (CAS 1187385-97-2) is a chemical compound with the molecular formula C13H9Cl2FN2O2 and a molecular weight of 315.12 g/mol. IUPAC name: benzyl N-(2,6-dichloro-5-fluoro-3-pyridinyl)carbamate. InChIKey: NQAJQDXUZGAAIC-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2FN2O2 |
|---|---|
| Molecular weight | 315.12 g/mol |
| IUPAC name | benzyl N-(2,6-dichloro-5-fluoro-3-pyridinyl)carbamate |
| InChIKey | NQAJQDXUZGAAIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC(=C(N=C2Cl)Cl)F |
Computed by PubChem (NCBI)