Products 1187386-31-7

CAS 1187386-31-7 is the registry number for 2-Chloro-4-(trifluoromethoxy)aniline hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-chloro-4-(trifluoromethoxy)aniline;hydrochloride (CAS 1187386-31-7) is a chemical compound with the molecular formula C7H6Cl2F3NO and a molecular weight of 248.03 g/mol. IUPAC name: 2-chloro-4-(trifluoromethoxy)aniline;hydrochloride. InChIKey: YEFJDCOIOFAQLK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6Cl2F3NO
Molecular weight248.03 g/mol
IUPAC name2-chloro-4-(trifluoromethoxy)aniline;hydrochloride
InChIKeyYEFJDCOIOFAQLK-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1OC(F)(F)F)Cl)N.Cl

Computed by PubChem (NCBI)