CAS 1187451-41-7 appears in our catalog under these names: Omidenepag, Omidenepag/ 99.67% (existing batch purity), (6-((N-(4-(1H-Pyrazol-1-yl)benzyl)pyridine-3-sulfonamido)methyl)pyridin-2-yl)glycine, Omidenepag, 99.86%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 1mg, 5 mg, 50 mg.
2-[[6-[[(4-pyrazol-1-ylphenyl)methyl-pyridin-3-ylsulfonylamino]methyl]-2-pyridinyl]amino]acetic acid (CAS 1187451-41-7) is a chemical compound with the molecular formula C23H22N6O4S and a molecular weight of 478.5 g/mol. IUPAC name: 2-[[6-[[(4-pyrazol-1-ylphenyl)methyl-pyridin-3-ylsulfonylamino]methyl]-2-pyridinyl]amino]acetic acid. InChIKey: YHGSTSNEOJUIRN-UHFFFAOYSA-N.
| Molecular formula | C23H22N6O4S |
|---|---|
| Molecular weight | 478.5 g/mol |
| IUPAC name | 2-[[6-[[(4-pyrazol-1-ylphenyl)methyl-pyridin-3-ylsulfonylamino]methyl]-2-pyridinyl]amino]acetic acid |
| InChIKey | YHGSTSNEOJUIRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)NCC(=O)O)CN(CC2=CC=C(C=C2)N3C=CC=N3)S(=O)(=O)C4=CN=CC=C4 |
Computed by PubChem (NCBI)