CAS 1187586-63-5 appears in our catalog under these names: Montelukast Impurity 29, Montelukast Impurity 6. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
2-[2-[(E)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]prop-2-enyl]phenyl]propan-2-ol (CAS 1187586-63-5) is a chemical compound with the molecular formula C29H26ClNO and a molecular weight of 440.0 g/mol. IUPAC name: 2-[2-[(E)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]prop-2-enyl]phenyl]propan-2-ol. InChIKey: DLLVZUPJFUZKDX-VXFWDVHGSA-N.
| Molecular formula | C29H26ClNO |
|---|---|
| Molecular weight | 440.0 g/mol |
| IUPAC name | 2-[2-[(E)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]prop-2-enyl]phenyl]propan-2-ol |
| InChIKey | DLLVZUPJFUZKDX-VXFWDVHGSA-N |
| SMILES | CC(C)(C1=CC=CC=C1C/C=C/C2=CC(=CC=C2)/C=C/C3=NC4=C(C=CC(=C4)Cl)C=C3)O |
Computed by PubChem (NCBI)