CAS 1187627-98-0 appears in our catalog under these names: N-p-Benzene Acetonitrile Menthane Carboxamide, >95% (HPLC), N-p- Benzene Acetonitrile Menthane Carboxamide. Offered by: TRC. Available pack sizes: 2,5g, 250mg.
(1R,2S,5R)-N-[4-(cyanomethyl)phenyl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide (CAS 1187627-98-0) is a chemical compound with the molecular formula C19H26N2O and a molecular weight of 298.4 g/mol. IUPAC name: (1R,2S,5R)-N-[4-(cyanomethyl)phenyl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide. InChIKey: FPJRGEOLQICYQZ-FHLIZLRMSA-N.
| Molecular formula | C19H26N2O |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | (1R,2S,5R)-N-[4-(cyanomethyl)phenyl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
| InChIKey | FPJRGEOLQICYQZ-FHLIZLRMSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)C(=O)NC2=CC=C(C=C2)CC#N)C(C)C |
Computed by PubChem (NCBI)