CAS 1187636-13-0 is the registry number for Rel-ethyl (1R,3R,4R)-3-fluoro-4-hydroxycyclopentane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (1R,3R,4R)-3-fluoro-4-hydroxycyclopentane-1-carboxylate (CAS 1187636-13-0) is a chemical compound with the molecular formula C8H13FO3 and a molecular weight of 176.19 g/mol. IUPAC name: ethyl (1R,3R,4R)-3-fluoro-4-hydroxycyclopentane-1-carboxylate. InChIKey: PHPKYVMNQYISJH-RRKCRQDMSA-N.
| Molecular formula | C8H13FO3 |
|---|---|
| Molecular weight | 176.19 g/mol |
| IUPAC name | ethyl (1R,3R,4R)-3-fluoro-4-hydroxycyclopentane-1-carboxylate |
| InChIKey | PHPKYVMNQYISJH-RRKCRQDMSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@H]([C@@H](C1)F)O |
Computed by PubChem (NCBI)