CAS 1187830-80-3 appears in our catalog under these names: 3-(2-Bromoimidazo(2,1-b)thiazol-6-yl)propanoic acid hydrochloride, 96%, 3–(2–Bromoimidazo(2,1–b)thiazol–6–yl)propanoicacidhydrochloride, 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride, 96%, 96%, 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride, 96%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
3-(2-bromoimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride (CAS 1187830-80-3) is a chemical compound with the molecular formula C8H8BrClN2O2S and a molecular weight of 311.58 g/mol. IUPAC name: 3-(2-bromoimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride. InChIKey: KMDHBXXAOXPFIC-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2O2S |
|---|---|
| Molecular weight | 311.58 g/mol |
| IUPAC name | 3-(2-bromoimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride |
| InChIKey | KMDHBXXAOXPFIC-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2N1C=C(S2)Br)CCC(=O)O.Cl |
Computed by PubChem (NCBI)