CAS 1187926-85-7 appears in our catalog under these names: 2-(((3-Methyl-4-nitropyridin-2-yl)methyl)sulfonyl)-1h-benzo[d]imidazole, 95%, Lansoprazole Impurity 26. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, on request.
2-[(3-methyl-4-nitro-2-pyridinyl)methylsulfonyl]-1H-benzimidazole (CAS 1187926-85-7) is a chemical compound with the molecular formula C14H12N4O4S and a molecular weight of 332.34 g/mol. IUPAC name: 2-[(3-methyl-4-nitro-2-pyridinyl)methylsulfonyl]-1H-benzimidazole. InChIKey: PDKDKUSPKCWWKS-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O4S |
|---|---|
| Molecular weight | 332.34 g/mol |
| IUPAC name | 2-[(3-methyl-4-nitro-2-pyridinyl)methylsulfonyl]-1H-benzimidazole |
| InChIKey | PDKDKUSPKCWWKS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CS(=O)(=O)C2=NC3=CC=CC=C3N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)