CAS 118803-30-8 appears in our catalog under these names: hUP1–IN–1 potassium, hUP1-IN-1 (potassium), 99.54%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 50mg, 25 mg, 50 mg, 10mM/1mL, 100 mg.
Potassium 5-cyano-4-methyl-6-oxo-1H-pyridin-2-olate (CAS 118803-30-8) is a chemical compound with the molecular formula C7H5KN2O2 and a molecular weight of 188.22 g/mol. IUPAC name: potassium 5-cyano-4-methyl-6-oxo-1H-pyridin-2-olate. InChIKey: PLXIXNNSODABNT-UHFFFAOYSA-M.
| Molecular formula | C7H5KN2O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | potassium 5-cyano-4-methyl-6-oxo-1H-pyridin-2-olate |
| InChIKey | PLXIXNNSODABNT-UHFFFAOYSA-M |
| SMILES | CC1=C(C(=O)NC(=C1)[O-])C#N.[K+] |
Computed by PubChem (NCBI)