CAS 1188077-59-9 is the registry number for 4-Fluoro-2-iodobenzo[d]thiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-fluoro-2-iodo-1,3-benzothiazole (CAS 1188077-59-9) is a chemical compound with the molecular formula C7H3FINS and a molecular weight of 279.08 g/mol. IUPAC name: 4-fluoro-2-iodo-1,3-benzothiazole. InChIKey: GGSANUIWQDTJJX-UHFFFAOYSA-N.
| Molecular formula | C7H3FINS |
|---|---|
| Molecular weight | 279.08 g/mol |
| IUPAC name | 4-fluoro-2-iodo-1,3-benzothiazole |
| InChIKey | GGSANUIWQDTJJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC(=N2)I)F |
Computed by PubChem (NCBI)