CAS 1188089-89-5 is the registry number for 6-(tert-Butyl)-2-(chloromethyl)benzo[d]thiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-tert-butyl-2-(chloromethyl)-1,3-benzothiazole (CAS 1188089-89-5) is a chemical compound with the molecular formula C12H14ClNS and a molecular weight of 239.76 g/mol. IUPAC name: 6-tert-butyl-2-(chloromethyl)-1,3-benzothiazole. InChIKey: UGTVVSQSPLFUEG-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNS |
|---|---|
| Molecular weight | 239.76 g/mol |
| IUPAC name | 6-tert-butyl-2-(chloromethyl)-1,3-benzothiazole |
| InChIKey | UGTVVSQSPLFUEG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)N=C(S2)CCl |
Computed by PubChem (NCBI)