CAS 1188122-06-6 appears in our catalog under these names: 2-Chloro-4-(2-fluorophenyl)-1,3-thiazole, 95%, 2-Chloro-4-(2-fluorophenyl)-1,3-thiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-4-(2-fluorophenyl)-1,3-thiazole (CAS 1188122-06-6) is a chemical compound with the molecular formula C9H5ClFNS and a molecular weight of 213.66 g/mol. IUPAC name: 2-chloro-4-(2-fluorophenyl)-1,3-thiazole. InChIKey: WQXURHFSSMANCZ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNS |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 2-chloro-4-(2-fluorophenyl)-1,3-thiazole |
| InChIKey | WQXURHFSSMANCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CSC(=N2)Cl)F |
Computed by PubChem (NCBI)