CAS 1188146-20-4 appears in our catalog under these names: 1,4,6-Trichloro-2,3-dihydro-1H-indene, 95%, 1,4,6-Trichloro-2,3-dihydro-1H-indene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,4,6-trichloro-2,3-dihydro-1H-indene (CAS 1188146-20-4) is a chemical compound with the molecular formula C9H7Cl3 and a molecular weight of 221.5 g/mol. IUPAC name: 1,4,6-trichloro-2,3-dihydro-1H-indene. InChIKey: QZOQWLZEVHEWLA-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl3 |
|---|---|
| Molecular weight | 221.5 g/mol |
| IUPAC name | 1,4,6-trichloro-2,3-dihydro-1H-indene |
| InChIKey | QZOQWLZEVHEWLA-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1Cl)C=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)