CAS 1188263-45-7 appears in our catalog under these names: Acetaminophen-d3 Sulphate Potassium Salt, 4-Acetaminophen-d3 Sulfate Potassium Salt, >95% (HPLC), 4–Acetaminophen–d3 Sulfate Potassium Salt, 4-Acetaminophen sulfate-d3 (potassium). Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 50mg, 1 mg, 10 mg.
Potassium [4-[(2,2,2-trideuterioacetyl)amino]phenyl] sulfate (CAS 1188263-45-7) is a chemical compound with the molecular formula C8H8KNO5S and a molecular weight of 272.34 g/mol. IUPAC name: potassium [4-[(2,2,2-trideuterioacetyl)amino]phenyl] sulfate. InChIKey: AJYPYWFCUWHZMZ-NIIDSAIPSA-M.
| Molecular formula | C8H8KNO5S |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | potassium [4-[(2,2,2-trideuterioacetyl)amino]phenyl] sulfate |
| InChIKey | AJYPYWFCUWHZMZ-NIIDSAIPSA-M |
| SMILES | [2H]C([2H])([2H])C(=O)NC1=CC=C(C=C1)OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)