CAS 1188263-51-5 appears in our catalog under these names: Tizanidine-d4 HCl, Tizanidine-d4 Hydrochloride, >95% (HPLC), Tizanidine–d4 (hydrochloride), Tizanidine-d4 (hydrochloride). Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 500μg, 1 mg.
5-chloro-N-(4,4,5,5-tetradeuterio-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine;hydrochloride (CAS 1188263-51-5) is a chemical compound with the molecular formula C9H9Cl2N5S and a molecular weight of 294.20 g/mol. IUPAC name: 5-chloro-N-(4,4,5,5-tetradeuterio-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine;hydrochloride. InChIKey: ZWUKMNZJRDGCTQ-URZLSVTISA-N.
| Molecular formula | C9H9Cl2N5S |
|---|---|
| Molecular weight | 294.20 g/mol |
| IUPAC name | 5-chloro-N-(4,4,5,5-tetradeuterio-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine;hydrochloride |
| InChIKey | ZWUKMNZJRDGCTQ-URZLSVTISA-N |
| SMILES | [2H]C1(C(N=C(N1)NC2=C(C=CC3=NSN=C32)Cl)([2H])[2H])[2H].Cl |
Computed by PubChem (NCBI)