Products 1188265-43-1
CAS 1188265-43-1 appears in our catalog under these names: Midodrine-d6 HCl, Midodrine-d6, Hydrochloride, Midodrine D6 hydrochloride, Midodrine-d6 (hydrochloride), 99.44%. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 5mg, 10 mg, 5 mg.
2-amino-N-[2-[2,5-bis(trideuteriomethoxy)phenyl]-2-hydroxyethyl]acetamide;hydrochloride (CAS 1188265-43-1) is a chemical compound with the molecular formula C12H19ClN2O4 and a molecular weight of 296.78 g/mol. IUPAC name: 2-amino-N-[2-[2,5-bis(trideuteriomethoxy)phenyl]-2-hydroxyethyl]acetamide;hydrochloride. InChIKey: MGCQZNBCJBRZDT-TXHXQZCNSA-N.
| Molecular formula | C12H19ClN2O4 |
|---|---|
| Molecular weight | 296.78 g/mol |
| IUPAC name | 2-amino-N-[2-[2,5-bis(trideuteriomethoxy)phenyl]-2-hydroxyethyl]acetamide;hydrochloride |
| InChIKey | MGCQZNBCJBRZDT-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=C(C=C1)OC([2H])([2H])[2H])C(CNC(=O)CN)O.Cl |
Computed by PubChem (NCBI)