Products 1188266-06-9
CAS 1188266-06-9 appears in our catalog under these names: p-Tyramine-d4 Hydrochloride, >95% (HPLC), Tyramine-d4 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 5mg, 500 μg.
4-(2-aminoethyl)-2,3,5,6-tetradeuteriophenol;hydrochloride (CAS 1188266-06-9) is a chemical compound with the molecular formula C8H12ClNO and a molecular weight of 177.66 g/mol. IUPAC name: 4-(2-aminoethyl)-2,3,5,6-tetradeuteriophenol;hydrochloride. InChIKey: RNISDHSYKZAWOK-FOMJDCLLSA-N.
| Molecular formula | C8H12ClNO |
|---|---|
| Molecular weight | 177.66 g/mol |
| IUPAC name | 4-(2-aminoethyl)-2,3,5,6-tetradeuteriophenol;hydrochloride |
| InChIKey | RNISDHSYKZAWOK-FOMJDCLLSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CCN)[2H])[2H])O)[2H].Cl |
Computed by PubChem (NCBI)