Products 1189884-47-6
CAS 1189884-47-6 appears in our catalog under these names: 2-(4-Hydroxyphenyl)ethyl-1,1,2,2-d4-amine HCl, 98 atom % D, min 98% Chemical Purity, p-Tyramine-d4 Hydrochloride, >95% (HPLC), Tyramine–d4 (hydrochloride), p-Tyramine-d4 (hydrochloride), 99.90%, D4-Tyramine hydrochloride. Offered by: CDN, TRC, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 0,1g, 0,05g, 1mg, 2,5mg, 5mg, 5 mg, 10 mg, 1 mg.
4-(2-amino-1,1,2,2-tetradeuterioethyl)phenol;hydrochloride (CAS 1189884-47-6) is a chemical compound with the molecular formula C8H12ClNO and a molecular weight of 177.66 g/mol. IUPAC name: 4-(2-amino-1,1,2,2-tetradeuterioethyl)phenol;hydrochloride. InChIKey: RNISDHSYKZAWOK-NXMSQKFDSA-N.
| Molecular formula | C8H12ClNO |
|---|---|
| Molecular weight | 177.66 g/mol |
| IUPAC name | 4-(2-amino-1,1,2,2-tetradeuterioethyl)phenol;hydrochloride |
| InChIKey | RNISDHSYKZAWOK-NXMSQKFDSA-N |
| SMILES | [2H]C([2H])(C1=CC=C(C=C1)O)C([2H])([2H])N.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-(2-amino-1,1,2,2-tetradeuterioethyl)phenol;hydrochloride, p-Tyramine-d4 Hydrochloride, Tyramine-d4 Hydrochloride, Tyramine-d4 (hydrochloride), p-Tyramine-d4 (hydrochloride), 2-(4-Hydroxyphenyl)ethyl-1,1,2,2-d4-amine hcl, 4-(2-amino-1,1,2,2-tetradeuterio-ethyl)phenol;hydrochloride, 4-[2-Amino(~2~H_4_)ethyl]phenol--hydrogen chloride (1/1)