Products 1188266-11-6
CAS 1188266-11-6 appears in our catalog under these names: rac-Duloxetine-d3 HCl, rac-Duloxetine-d3 Hydrochloride, Duloxetine–d3 (hydrochloride), Duloxetine-d3 HCl. Offered by: Chemat Brand, TRC, GLPBio, TargetMol. Available pack sizes: on request, 100mg, 1mg, 5mg, 10mg, 25mg.
3-naphthalen-1-yloxy-3-thiophen-2-yl-N-(trideuteriomethyl)propan-1-amine;hydrochloride (CAS 1188266-11-6) is a chemical compound with the molecular formula C18H20ClNOS and a molecular weight of 336.9 g/mol. IUPAC name: 3-naphthalen-1-yloxy-3-thiophen-2-yl-N-(trideuteriomethyl)propan-1-amine;hydrochloride. InChIKey: BFFSMCNJSOPUAY-NIIDSAIPSA-N.
| Molecular formula | C18H20ClNOS |
|---|---|
| Molecular weight | 336.9 g/mol |
| IUPAC name | 3-naphthalen-1-yloxy-3-thiophen-2-yl-N-(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChIKey | BFFSMCNJSOPUAY-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])NCCC(C1=CC=CS1)OC2=CC=CC3=CC=CC=C32.Cl |
Computed by PubChem (NCBI)