Products 118843-18-8

CAS 118843-18-8 is the registry number for 6-Hydroxy-N,N,N-trimethylhexan-1-aminium Bromide, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.

Structural formula: {0} (CAS {1})

6-hydroxyhexyl(trimethyl)azanium bromide (CAS 118843-18-8) is a chemical compound with the molecular formula C9H22BrNO and a molecular weight of 240.18 g/mol. IUPAC name: 6-hydroxyhexyl(trimethyl)azanium bromide. InChIKey: HUCAMSNMGAEXCX-UHFFFAOYSA-M.

Identity
Molecular formulaC9H22BrNO
Molecular weight240.18 g/mol
IUPAC name6-hydroxyhexyl(trimethyl)azanium bromide
InChIKeyHUCAMSNMGAEXCX-UHFFFAOYSA-M
SMILESC[N+](C)(C)CCCCCCO.[Br-]

Computed by PubChem (NCBI)