CAS 1188487-83-3 appears in our catalog under these names: Nifuroxazide-d4, Nifuroxazide–d4. Offered by: TRC, GLPBio, TargetMol, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 500μg, 1 mg, 10 mg, 5 mg.
2,3,5,6-tetradeuterio-4-hydroxy-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide (CAS 1188487-83-3) is a chemical compound with the molecular formula C12H9N3O5 and a molecular weight of 279.24 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-hydroxy-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide. InChIKey: YCWSUKQGVSGXJO-WNGOOFDKSA-N.
| Molecular formula | C12H9N3O5 |
|---|---|
| Molecular weight | 279.24 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-hydroxy-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide |
| InChIKey | YCWSUKQGVSGXJO-WNGOOFDKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)N/N=C/C2=CC=C(O2)[N+](=O)[O-])[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)