CAS 1188530-96-2 appears in our catalog under these names: (2S)-2-Amino-N-cyclopentyl-3-methylbutanamide, 98%, (S)-2-Amino-N-cyclopentyl-3-methylbutanamide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(2S)-2-amino-N-cyclopentyl-3-methylbutanamide (CAS 1188530-96-2) is a chemical compound with the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. IUPAC name: (2S)-2-amino-N-cyclopentyl-3-methylbutanamide. InChIKey: GRJJRKRYXRWSAK-VIFPVBQESA-N.
| Molecular formula | C10H20N2O |
|---|---|
| Molecular weight | 184.28 g/mol |
| IUPAC name | (2S)-2-amino-N-cyclopentyl-3-methylbutanamide |
| InChIKey | GRJJRKRYXRWSAK-VIFPVBQESA-N |
| SMILES | CC(C)[C@@H](C(=O)NC1CCCC1)N |
Computed by PubChem (NCBI)