CAS 1188546-10-2 appears in our catalog under these names: 10-(4'-(Diphenylamino)biphenyl-4-yl)acridin-9(10H )-one, 99%, Poly((9,9-dioctyl-2,7-divinylenefluorenylene)-alt-(4,4'-biphenylene)). Offered by: Lumtec. Available pack sizes: 1g, 5g, On request.
10-[4-[4-(N-phenylanilino)phenyl]phenyl]acridin-9-one (CAS 1188546-10-2) is a chemical compound with the molecular formula C37H26N2O and a molecular weight of 514.6 g/mol. IUPAC name: 10-[4-[4-(N-phenylanilino)phenyl]phenyl]acridin-9-one. InChIKey: AZKNLRRXRBAHSD-UHFFFAOYSA-N.
| Molecular formula | C37H26N2O |
|---|---|
| Molecular weight | 514.6 g/mol |
| IUPAC name | 10-[4-[4-(N-phenylanilino)phenyl]phenyl]acridin-9-one |
| InChIKey | AZKNLRRXRBAHSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)N5C6=CC=CC=C6C(=O)C7=CC=CC=C75 |
Computed by PubChem (NCBI)