Products 1188911-72-9

CAS 1188911-72-9 is the registry number for Methyl 3,3,3-trifluoro-2,2-dimethylpropanoate, 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g, 25g, 100g.

Structural formula: {0} (CAS {1})

Methyl 3,3,3-trifluoro-2,2-dimethylpropanoate (CAS 1188911-72-9) is a chemical compound with the molecular formula C6H9F3O2 and a molecular weight of 170.13 g/mol. IUPAC name: methyl 3,3,3-trifluoro-2,2-dimethylpropanoate. InChIKey: ZVXAFVCHEIPHDR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9F3O2
Molecular weight170.13 g/mol
IUPAC namemethyl 3,3,3-trifluoro-2,2-dimethylpropanoate
InChIKeyZVXAFVCHEIPHDR-UHFFFAOYSA-N
SMILESCC(C)(C(=O)OC)C(F)(F)F

Computed by PubChem (NCBI)