CAS 1188926-14-8 appears in our catalog under these names: 5-Bromo-6-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)nicotinic acid, 95%, 5-Bromo-6-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)nicotinic acid, 97+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
5-bromo-6-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 1188926-14-8) is a chemical compound with the molecular formula C9H4BrF6NO3 and a molecular weight of 368.03 g/mol. IUPAC name: 5-bromo-6-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: CBLFAJZVUTVLKR-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF6NO3 |
|---|---|
| Molecular weight | 368.03 g/mol |
| IUPAC name | 5-bromo-6-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | CBLFAJZVUTVLKR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Br)OCC(F)(F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)