CAS 1188945-12-1 appears in our catalog under these names: 1-(3,4,5-Trifluorophenyl)-1h-pyrrole-2,5-dione, 95%, 1-(3,4,5-Trifluorophenyl)-1H-pyrrole-2,5-dione, 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 250mg.
1-(3,4,5-trifluorophenyl)pyrrole-2,5-dione (CAS 1188945-12-1) is a chemical compound with the molecular formula C10H4F3NO2 and a molecular weight of 227.14 g/mol. IUPAC name: 1-(3,4,5-trifluorophenyl)pyrrole-2,5-dione. InChIKey: PHOCESHVSZLHJP-UHFFFAOYSA-N.
| Molecular formula | C10H4F3NO2 |
|---|---|
| Molecular weight | 227.14 g/mol |
| IUPAC name | 1-(3,4,5-trifluorophenyl)pyrrole-2,5-dione |
| InChIKey | PHOCESHVSZLHJP-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)C2=CC(=C(C(=C2)F)F)F |
Computed by PubChem (NCBI)