CAS 1188964-88-6 is the registry number for 2-Hydroxy-3-pyridinecarboximidamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-oxo-1H-pyridine-3-carboximidamide;hydrochloride (CAS 1188964-88-6) is a chemical compound with the molecular formula C6H8ClN3O and a molecular weight of 173.60 g/mol. IUPAC name: 2-oxo-1H-pyridine-3-carboximidamide;hydrochloride. InChIKey: OLNJXJILJSVKQR-UHFFFAOYSA-N.
| Molecular formula | C6H8ClN3O |
|---|---|
| Molecular weight | 173.60 g/mol |
| IUPAC name | 2-oxo-1H-pyridine-3-carboximidamide;hydrochloride |
| InChIKey | OLNJXJILJSVKQR-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C(=C1)C(=N)N.Cl |
Computed by PubChem (NCBI)