Products 118910-83-1
CAS 118910-83-1 is the registry number for Pyridaben Carboxylic Acid. Offered by: TRC. Available pack sizes: 100mg.
2-[4-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)sulfanylmethyl]phenyl]-2-methylpropanoic acid (CAS 118910-83-1) is a chemical compound with the molecular formula C19H23ClN2O3S and a molecular weight of 394.9 g/mol. IUPAC name: 2-[4-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)sulfanylmethyl]phenyl]-2-methylpropanoic acid. InChIKey: NJUKOAUUDPMBRV-UHFFFAOYSA-N.
| Molecular formula | C19H23ClN2O3S |
|---|---|
| Molecular weight | 394.9 g/mol |
| IUPAC name | 2-[4-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)sulfanylmethyl]phenyl]-2-methylpropanoic acid |
| InChIKey | NJUKOAUUDPMBRV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=O)C(=C(C=N1)SCC2=CC=C(C=C2)C(C)(C)C(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
Pyridaben Carboxylic Acid