Products 1189126-31-5

CAS 1189126-31-5 is the registry number for 3-Methoxy-4-(2-methoxyethoxy)phenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

[3-methoxy-4-(2-methoxyethoxy)phenyl]boronic acid (CAS 1189126-31-5) is a chemical compound with the molecular formula C10H15BO5 and a molecular weight of 226.04 g/mol. IUPAC name: [3-methoxy-4-(2-methoxyethoxy)phenyl]boronic acid. InChIKey: YUBMDYZNCBFIEJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15BO5
Molecular weight226.04 g/mol
IUPAC name[3-methoxy-4-(2-methoxyethoxy)phenyl]boronic acid
InChIKeyYUBMDYZNCBFIEJ-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1)OCCOC)OC)(O)O

Computed by PubChem (NCBI)