CAS 1189348-94-4 is the registry number for Almotriptan Malate N-Oxide. Offered by: TRC. Available pack sizes: 250mg.
N,N-dimethyl-2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]ethanamine oxide;2-hydroxybutanedioic acid (CAS 1189348-94-4) is a chemical compound with the molecular formula C21H31N3O8S and a molecular weight of 485.6 g/mol. IUPAC name: N,N-dimethyl-2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]ethanamine oxide;2-hydroxybutanedioic acid. InChIKey: DCLIUSKEXVXBHH-UHFFFAOYSA-N.
| Molecular formula | C21H31N3O8S |
|---|---|
| Molecular weight | 485.6 g/mol |
| IUPAC name | N,N-dimethyl-2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]ethanamine oxide;2-hydroxybutanedioic acid |
| InChIKey | DCLIUSKEXVXBHH-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCC1=CNC2=C1C=C(C=C2)CS(=O)(=O)N3CCCC3)[O-].C(C(C(=O)O)O)C(=O)O |
Computed by PubChem (NCBI)