CAS 1189375-06-1 appears in our catalog under these names: Torasemide–d7, Torasemide-d7 (Torsemide-d7), Torasemide-d7, Torsemide-d7, >95% (HPLC), Torsemide-d7 (iso-propyl-d7), 99 atom % D, min 98% Chemical Purity. Offered by: GLPBio, Chemat Brand, Hubei YoungXin, TRC, CDN. Available pack sizes: 1mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg, 0,01g.
1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-[[4-(3-methylanilino)-3-pyridinyl]sulfonyl]urea (CAS 1189375-06-1) is a chemical compound with the molecular formula C16H20N4O3S and a molecular weight of 355.5 g/mol. IUPAC name: 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-[[4-(3-methylanilino)-3-pyridinyl]sulfonyl]urea. InChIKey: NGBFQHCMQULJNZ-UENXPIBQSA-N.
| Molecular formula | C16H20N4O3S |
|---|---|
| Molecular weight | 355.5 g/mol |
| IUPAC name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-[[4-(3-methylanilino)-3-pyridinyl]sulfonyl]urea |
| InChIKey | NGBFQHCMQULJNZ-UENXPIBQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC(=O)NS(=O)(=O)C1=C(C=CN=C1)NC2=CC=CC(=C2)C |
Computed by PubChem (NCBI)