Products 1189397-95-2
CAS 1189397-95-2 is the registry number for 9-O-Demethyltrigonostemone. Offered by: TargetMol. Available pack sizes: 25mg, 50mg, 100mg.
9-hydroxy-3,6-dimethoxy-1,1,7-trimethylphenanthren-2-one (CAS 1189397-95-2) is a chemical compound with the molecular formula C19H20O4 and a molecular weight of 312.4 g/mol. IUPAC name: 9-hydroxy-3,6-dimethoxy-1,1,7-trimethylphenanthren-2-one. InChIKey: LPMUQQPZLWUZEQ-UHFFFAOYSA-N.
| Molecular formula | C19H20O4 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 9-hydroxy-3,6-dimethoxy-1,1,7-trimethylphenanthren-2-one |
| InChIKey | LPMUQQPZLWUZEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C3C(=C2C=C1OC)C=C(C(=O)C3(C)C)OC)O |
Computed by PubChem (NCBI)