Products 1189424-36-9
CAS 1189424-36-9 appears in our catalog under these names: Desalkyl Ebastine-d5, 4-Benzhydryloxy-piperidine-d5. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg, 10 mg.
4-[(2,3,4,5,6-pentadeuteriophenyl)-phenylmethoxy]piperidine (CAS 1189424-36-9) is a chemical compound with the molecular formula C18H21NO and a molecular weight of 272.4 g/mol. IUPAC name: 4-[(2,3,4,5,6-pentadeuteriophenyl)-phenylmethoxy]piperidine. InChIKey: OQAOREVBRZVXDS-DYVTXVBDSA-N.
| Molecular formula | C18H21NO |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | 4-[(2,3,4,5,6-pentadeuteriophenyl)-phenylmethoxy]piperidine |
| InChIKey | OQAOREVBRZVXDS-DYVTXVBDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C2=CC=CC=C2)OC3CCNCC3)[2H])[2H] |
Computed by PubChem (NCBI)