CAS 1189427-23-3 appears in our catalog under these names: Cycloguanil-d4 Hydrochloride, >95% (HPLC), Cycloguanil-d4 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
1-(4-chloro-2,3,5,6-tetradeuteriophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrochloride (CAS 1189427-23-3) is a chemical compound with the molecular formula C11H15Cl2N5 and a molecular weight of 292.20 g/mol. IUPAC name: 1-(4-chloro-2,3,5,6-tetradeuteriophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrochloride. InChIKey: MOUAPRKJJUXEIE-HGSONKNXSA-N.
| Molecular formula | C11H15Cl2N5 |
|---|---|
| Molecular weight | 292.20 g/mol |
| IUPAC name | 1-(4-chloro-2,3,5,6-tetradeuteriophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrochloride |
| InChIKey | MOUAPRKJJUXEIE-HGSONKNXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N2C(=NC(=NC2(C)C)N)N)[2H])[2H])Cl)[2H].Cl |
Computed by PubChem (NCBI)