Products 1189442-18-9

CAS 1189442-18-9 is the registry number for Phenoxy-d5-acetic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(2,3,4,5,6-pentadeuteriophenoxy)acetate (CAS 1189442-18-9) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 185.23 g/mol. IUPAC name: ethyl 2-(2,3,4,5,6-pentadeuteriophenoxy)acetate. InChIKey: MGZFVSUXQXCEHM-DKFMXDSJSA-N.

Identity
Molecular formulaC10H12O3
Molecular weight185.23 g/mol
IUPAC nameethyl 2-(2,3,4,5,6-pentadeuteriophenoxy)acetate
InChIKeyMGZFVSUXQXCEHM-DKFMXDSJSA-N
SMILES[2H]C1=C(C(=C(C(=C1[2H])[2H])OCC(=O)OCC)[2H])[2H]

Computed by PubChem (NCBI)