Products 1189458-14-7
CAS 1189458-14-7 appears in our catalog under these names: 2-Amino-3-methyl-9H-pyrido(2,3-b)indole-d3, 2–Amino–3–methyl–9H–pyrido(2，3–b)indole–d3, 2-Amino-3-methyl-9H-pyrido[2,3-b]indole-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 5mg, 1mg, 500 μg, 1 mg, 5 mg.
3-(trideuteriomethyl)-9H-pyrido[2,3-b]indol-2-amine (CAS 1189458-14-7) is a chemical compound with the molecular formula C12H11N3 and a molecular weight of 200.25 g/mol. IUPAC name: 3-(trideuteriomethyl)-9H-pyrido[2,3-b]indol-2-amine. InChIKey: IVLCGFRPPGNALI-FIBGUPNXSA-N.
| Molecular formula | C12H11N3 |
|---|---|
| Molecular weight | 200.25 g/mol |
| IUPAC name | 3-(trideuteriomethyl)-9H-pyrido[2,3-b]indol-2-amine |
| InChIKey | IVLCGFRPPGNALI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC2=C(NC3=CC=CC=C32)N=C1N |
Computed by PubChem (NCBI)