CAS 1189466-51-0 is the registry number for 4–Amino–N,1–dimethyl–5–imidazolecarboxamide–d3. Offered by: GLPBio. Available pack sizes: 5mg.
5-amino-3-methyl-N-(trideuteriomethyl)imidazole-4-carboxamide (CAS 1189466-51-0) is a chemical compound with the molecular formula C6H10N4O and a molecular weight of 157.19 g/mol. IUPAC name: 5-amino-3-methyl-N-(trideuteriomethyl)imidazole-4-carboxamide. InChIKey: ZKLBVKAZENBDRQ-FIBGUPNXSA-N.
| Molecular formula | C6H10N4O |
|---|---|
| Molecular weight | 157.19 g/mol |
| IUPAC name | 5-amino-3-methyl-N-(trideuteriomethyl)imidazole-4-carboxamide |
| InChIKey | ZKLBVKAZENBDRQ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)C1=C(N=CN1C)N |
Computed by PubChem (NCBI)