Products 1189468-67-4
CAS 1189468-67-4 appears in our catalog under these names: rac N,O-Didesmethyl Venlafaxine-d3, >95% (HPLC), N,O-Didesmethylvenlafaxine-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
4-[1-(1-hydroxycyclohexyl)-2-(trideuteriomethylamino)ethyl]phenol (CAS 1189468-67-4) is a chemical compound with the molecular formula C15H23NO2 and a molecular weight of 252.37 g/mol. IUPAC name: 4-[1-(1-hydroxycyclohexyl)-2-(trideuteriomethylamino)ethyl]phenol. InChIKey: MMSWXJSQCAEDLK-FIBGUPNXSA-N.
| Molecular formula | C15H23NO2 |
|---|---|
| Molecular weight | 252.37 g/mol |
| IUPAC name | 4-[1-(1-hydroxycyclohexyl)-2-(trideuteriomethylamino)ethyl]phenol |
| InChIKey | MMSWXJSQCAEDLK-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCC(C1=CC=C(C=C1)O)C2(CCCCC2)O |
Computed by PubChem (NCBI)