CAS 1189480-47-4 appears in our catalog under these names: Hydroxyzine D8, Hydroxyzine D8, Hydroxyzine-d8, Hydroxyzine D8, 99.0%, 99.0%, Hydroxyzine D8, 99.0%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg.
2-[2-[4-[(4-chlorophenyl)-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]ethoxy]ethanol (CAS 1189480-47-4) is a chemical compound with the molecular formula C21H27ClN2O2 and a molecular weight of 383.0 g/mol. IUPAC name: 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]ethoxy]ethanol. InChIKey: ZQDWXGKKHFNSQK-BGKXKQMNSA-N.
| Molecular formula | C21H27ClN2O2 |
|---|---|
| Molecular weight | 383.0 g/mol |
| IUPAC name | 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]ethoxy]ethanol |
| InChIKey | ZQDWXGKKHFNSQK-BGKXKQMNSA-N |
| SMILES | [2H]C1(C(N(C(C(N1CCOCCO)([2H])[2H])([2H])[2H])C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl)([2H])[2H])[2H] |
Computed by PubChem (NCBI)