Products 1189481-89-7

CAS 1189481-89-7 is the registry number for 4,5-Dichloro-6-pyridazone-15N2. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.

Structural formula: {0} (CAS {1})

4,5-dichloro-(1,2-15N2)1H-pyridazin-6-one (CAS 1189481-89-7) is a chemical compound with the molecular formula C4H2Cl2N2O and a molecular weight of 166.96 g/mol. IUPAC name: 4,5-dichloro-(1,2-15N2)1H-pyridazin-6-one. InChIKey: VJWXIRQLLGYIDI-BFGUONQLSA-N.

Identity
Molecular formulaC4H2Cl2N2O
Molecular weight166.96 g/mol
IUPAC name4,5-dichloro-(1,2-15N2)1H-pyridazin-6-one
InChIKeyVJWXIRQLLGYIDI-BFGUONQLSA-N
SMILESC1=[15N][15NH]C(=O)C(=C1Cl)Cl

Computed by PubChem (NCBI)