CAS 1189481-89-7 is the registry number for 4,5-Dichloro-6-pyridazone-15N2. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
4,5-dichloro-(1,2-15N2)1H-pyridazin-6-one (CAS 1189481-89-7) is a chemical compound with the molecular formula C4H2Cl2N2O and a molecular weight of 166.96 g/mol. IUPAC name: 4,5-dichloro-(1,2-15N2)1H-pyridazin-6-one. InChIKey: VJWXIRQLLGYIDI-BFGUONQLSA-N.
| Molecular formula | C4H2Cl2N2O |
|---|---|
| Molecular weight | 166.96 g/mol |
| IUPAC name | 4,5-dichloro-(1,2-15N2)1H-pyridazin-6-one |
| InChIKey | VJWXIRQLLGYIDI-BFGUONQLSA-N |
| SMILES | C1=[15N][15NH]C(=O)C(=C1Cl)Cl |
Computed by PubChem (NCBI)