Products 1189483-12-2
CAS 1189483-12-2 is the registry number for rac Terpinen-4-ol-d7. Offered by: TRC. Available pack sizes: 25mg.
1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-methylcyclohex-3-en-1-ol (CAS 1189483-12-2) is a chemical compound with the molecular formula C10H18O and a molecular weight of 161.29 g/mol. IUPAC name: 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-methylcyclohex-3-en-1-ol. InChIKey: WRYLYDPHFGVWKC-UNAVHCQLSA-N.
| Molecular formula | C10H18O |
|---|---|
| Molecular weight | 161.29 g/mol |
| IUPAC name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-methylcyclohex-3-en-1-ol |
| InChIKey | WRYLYDPHFGVWKC-UNAVHCQLSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1(CCC(=CC1)C)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)