CAS 118949-22-7 is the registry number for (Rac)-Vorozole. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-[(4-chlorophenyl)-(1,2,4-triazol-1-yl)methyl]-1-methylbenzotriazole (CAS 118949-22-7) is a chemical compound with the molecular formula C16H13ClN6 and a molecular weight of 324.77 g/mol. IUPAC name: 6-[(4-chlorophenyl)-(1,2,4-triazol-1-yl)methyl]-1-methylbenzotriazole. InChIKey: XLMPPFTZALNBFS-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN6 |
|---|---|
| Molecular weight | 324.77 g/mol |
| IUPAC name | 6-[(4-chlorophenyl)-(1,2,4-triazol-1-yl)methyl]-1-methylbenzotriazole |
| InChIKey | XLMPPFTZALNBFS-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)C(C3=CC=C(C=C3)Cl)N4C=NC=N4)N=N1 |
Computed by PubChem (NCBI)