Products 1189493-66-0
CAS 1189493-66-0 is the registry number for 3-Ethoxyphenol-d5. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(1,1,2,2,2-pentadeuterioethoxy)phenol (CAS 1189493-66-0) is a chemical compound with the molecular formula C8H10O2 and a molecular weight of 143.19 g/mol. IUPAC name: 3-(1,1,2,2,2-pentadeuterioethoxy)phenol. InChIKey: VBIKLMJHBGFTPV-ZBJDZAJPSA-N.
| Molecular formula | C8H10O2 |
|---|---|
| Molecular weight | 143.19 g/mol |
| IUPAC name | 3-(1,1,2,2,2-pentadeuterioethoxy)phenol |
| InChIKey | VBIKLMJHBGFTPV-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=CC=CC(=C1)O |
Computed by PubChem (NCBI)