CAS 1189494-00-5 appears in our catalog under these names: N-Benzylpiperazine-d8 Dihydrochloride (1.0mg/ml in Acetonitrile), N-Benzylpiperazine-d8 Dihydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 1x1ml, 10mg, 1mg, 5mg, 25mg, 50mg.
1-benzyl-2,2,3,3,5,5,6,6-octadeuteriopiperazine (CAS 1189494-00-5) is a chemical compound with the molecular formula C11H16N2 and a molecular weight of 184.31 g/mol. IUPAC name: 1-benzyl-2,2,3,3,5,5,6,6-octadeuteriopiperazine. InChIKey: IQXXEPZFOOTTBA-COMRDEPKSA-N.
| Molecular formula | C11H16N2 |
|---|---|
| Molecular weight | 184.31 g/mol |
| IUPAC name | 1-benzyl-2,2,3,3,5,5,6,6-octadeuteriopiperazine |
| InChIKey | IQXXEPZFOOTTBA-COMRDEPKSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])CC2=CC=CC=C2)([2H])[2H])[2H] |
Computed by PubChem (NCBI)