Products 1189498-49-4
CAS 1189498-49-4 is the registry number for Bromopride-d3. Offered by: Hubei YoungXin, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-amino-5-bromo-N-[2-(diethylamino)ethyl]-2-(trideuteriomethoxy)benzamide (CAS 1189498-49-4) is a chemical compound with the molecular formula C14H22BrN3O2 and a molecular weight of 347.27 g/mol. IUPAC name: 4-amino-5-bromo-N-[2-(diethylamino)ethyl]-2-(trideuteriomethoxy)benzamide. InChIKey: GIYAQDDTCWHPPL-HPRDVNIFSA-N.
| Molecular formula | C14H22BrN3O2 |
|---|---|
| Molecular weight | 347.27 g/mol |
| IUPAC name | 4-amino-5-bromo-N-[2-(diethylamino)ethyl]-2-(trideuteriomethoxy)benzamide |
| InChIKey | GIYAQDDTCWHPPL-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=C(C=C1C(=O)NCCN(CC)CC)Br)N |
Computed by PubChem (NCBI)