Products 1189499-82-8
CAS 1189499-82-8 appears in our catalog under these names: 1-Methyl-4-hydroxypiperidine-d4, 1-Methylpiperidin-4-ol-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 500mg, 50mg, 100 mg, 500 mg, 50 mg.
2,2,6,6-tetradeuterio-1-methylpiperidin-4-ol (CAS 1189499-82-8) is a chemical compound with the molecular formula C6H13NO and a molecular weight of 119.20 g/mol. IUPAC name: 2,2,6,6-tetradeuterio-1-methylpiperidin-4-ol. InChIKey: BAUWRHPMUVYFOD-CQOLUAMGSA-N.
| Molecular formula | C6H13NO |
|---|---|
| Molecular weight | 119.20 g/mol |
| IUPAC name | 2,2,6,6-tetradeuterio-1-methylpiperidin-4-ol |
| InChIKey | BAUWRHPMUVYFOD-CQOLUAMGSA-N |
| SMILES | [2H]C1(CC(CC(N1C)([2H])[2H])O)[2H] |
Computed by PubChem (NCBI)