CAS 1189501-77-6 is the registry number for 4-Methoxy-2,3,6-trimethylbenzyl Alcohol-d3. Offered by: TRC. Available pack sizes: 100mg, 10mg.
[2,3,6-trimethyl-4-(trideuteriomethoxy)phenyl]methanol (CAS 1189501-77-6) is a chemical compound with the molecular formula C11H16O2 and a molecular weight of 183.26 g/mol. IUPAC name: [2,3,6-trimethyl-4-(trideuteriomethoxy)phenyl]methanol. InChIKey: VMSYOJIGAZHOLW-GKOSEXJESA-N.
| Molecular formula | C11H16O2 |
|---|---|
| Molecular weight | 183.26 g/mol |
| IUPAC name | [2,3,6-trimethyl-4-(trideuteriomethoxy)phenyl]methanol |
| InChIKey | VMSYOJIGAZHOLW-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C(=C(C(=C1)C)CO)C)C |
Computed by PubChem (NCBI)