Products 1189502-84-8
CAS 1189502-84-8 is the registry number for 3-Methyl-2-buten-1-yl Thiolacetate-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
S-[4,4,4-trideuterio-3-(trideuteriomethyl)but-2-enyl] ethanethioate (CAS 1189502-84-8) is a chemical compound with the molecular formula C7H12OS and a molecular weight of 150.27 g/mol. IUPAC name: S-[4,4,4-trideuterio-3-(trideuteriomethyl)but-2-enyl] ethanethioate. InChIKey: HYSBJYIGYSBFQN-WFGJKAKNSA-N.
| Molecular formula | C7H12OS |
|---|---|
| Molecular weight | 150.27 g/mol |
| IUPAC name | S-[4,4,4-trideuterio-3-(trideuteriomethyl)but-2-enyl] ethanethioate |
| InChIKey | HYSBJYIGYSBFQN-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(=CCSC(=O)C)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)