CAS 1189510-77-7 appears in our catalog under these names: Omethoate-d3, >95% (GC), Omethoate-d3. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
2-dimethoxyphosphorylsulfanyl-N-(trideuteriomethyl)acetamide (CAS 1189510-77-7) is a chemical compound with the molecular formula C5H12NO4PS and a molecular weight of 216.21 g/mol. IUPAC name: 2-dimethoxyphosphorylsulfanyl-N-(trideuteriomethyl)acetamide. InChIKey: PZXOQEXFMJCDPG-FIBGUPNXSA-N.
| Molecular formula | C5H12NO4PS |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | 2-dimethoxyphosphorylsulfanyl-N-(trideuteriomethyl)acetamide |
| InChIKey | PZXOQEXFMJCDPG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)CSP(=O)(OC)OC |
Computed by PubChem (NCBI)