CAS 1189556-60-2 appears in our catalog under these names: Anthracen-9-yltrimethoxysilane, 95%, 9–Anthracenyl Trimethoxysilane. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 5g, 25g.
Anthracen-9-yl(trimethoxy)silane (CAS 1189556-60-2) is a chemical compound with the molecular formula C17H18O3Si and a molecular weight of 298.41 g/mol. IUPAC name: anthracen-9-yl(trimethoxy)silane. InChIKey: IWEWJEBCCWXJRF-UHFFFAOYSA-N.
| Molecular formula | C17H18O3Si |
|---|---|
| Molecular weight | 298.41 g/mol |
| IUPAC name | anthracen-9-yl(trimethoxy)silane |
| InChIKey | IWEWJEBCCWXJRF-UHFFFAOYSA-N |
| SMILES | CO[Si](C1=C2C=CC=CC2=CC3=CC=CC=C31)(OC)OC |
Computed by PubChem (NCBI)